C13H18N2O2 — CID 63558300
N-[[2-(oxolan-3-yloxy)-4-pyridinyl]methyl]cyclopropanamine (PubChem CID 63558300) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is N-[[2-(oxolan-3-yloxy)-4-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(oxolan-3-yloxy)-4-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 63558300 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N-[[2-(oxolan-3-yloxy)-4-pyridinyl]methyl]cyclopropanamine |
| SMILES | c1cc(CNC2CC2)cc(OC2CCOC2)n1 |
| InChI | InChI=1S/C13H18N2O2/c1-2-11(1)15-8-10-3-5-14-13(7-10)17-12-4-6-16-9-12/h3,5,7,11-12,15H,1-2,4,6,8-9H2 |
| InChIKey | IYYMIDGHYGQCID-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |