C10H13NO2S — CID 63564354
2-(2-methyl-1,3-thiazol-4-yl)-1-(oxolan-3-yl)ethanone (PubChem CID 63564354) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)-1-(oxolan-3-yl)ethanone.
| Compound Name | 2-(2-methyl-1,3-thiazol-4-yl)-1-(oxolan-3-yl)ethanone |
|---|---|
| PubChem CID | 63564354 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-4-yl)-1-(oxolan-3-yl)ethanone |
| SMILES | Cc1nc(CC(=O)C2CCOC2)cs1 |
| InChI | InChI=1S/C10H13NO2S/c1-7-11-9(6-14-7)4-10(12)8-2-3-13-5-8/h6,8H,2-5H2,1H3 |
| InChIKey | IXMWVCZIIIMIHY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |