C17H19ClFN — CID 63567303
4-(chloromethyl)-N-[1-(2-fluorophenyl)ethyl]-N,2-dimethylaniline (PubChem CID 63567303) has the molecular formula C17H19ClFN and a molecular weight of 291.80 g/mol. Its IUPAC name is 4-(chloromethyl)-N-[1-(2-fluorophenyl)ethyl]-N,2-dimethylaniline.
| Compound Name | 4-(chloromethyl)-N-[1-(2-fluorophenyl)ethyl]-N,2-dimethylaniline |
|---|---|
| PubChem CID | 63567303 |
| Molecular Formula | C17H19ClFN |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 4-(chloromethyl)-N-[1-(2-fluorophenyl)ethyl]-N,2-dimethylaniline |
| SMILES | Cc1cc(CCl)ccc1N(C)C(C)c1ccccc1F |
| InChI | InChI=1S/C17H19ClFN/c1-12-10-14(11-18)8-9-17(12)20(3)13(2)15-6-4-5-7-16(15)19/h4-10,13H,11H2,1-3H3 |
| InChIKey | KNKDIIXHLJSQIQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|