C17H24BrNO — CID 63567709
1-(4-bromophenyl)-2-[(4-ethylcyclohexyl)-methylamino]ethanone (PubChem CID 63567709) has the molecular formula C17H24BrNO and a molecular weight of 338.29 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[(4-ethylcyclohexyl)-methylamino]ethanone.
| Compound Name | 1-(4-bromophenyl)-2-[(4-ethylcyclohexyl)-methylamino]ethanone |
|---|---|
| PubChem CID | 63567709 |
| Molecular Formula | C17H24BrNO |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 1-(4-bromophenyl)-2-[(4-ethylcyclohexyl)-methylamino]ethanone |
| SMILES | CCC1CCC(N(C)CC(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C17H24BrNO/c1-3-13-4-10-16(11-5-13)19(2)12-17(20)14-6-8-15(18)9-7-14/h6-9,13,16H,3-5,10-12H2,1-2H3 |
| InChIKey | OSFOPWWBZAXFQW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |