C17H22BrNO — CID 64522575
1-(4-bromophenyl)-4-[cyclopropyl(cyclopropylmethyl)amino]butan-1-one (PubChem CID 64522575) has the molecular formula C17H22BrNO and a molecular weight of 336.27 g/mol. Its IUPAC name is 1-(4-bromophenyl)-4-[cyclopropyl(cyclopropylmethyl)amino]butan-1-one.
| Compound Name | 1-(4-bromophenyl)-4-[cyclopropyl(cyclopropylmethyl)amino]butan-1-one |
|---|---|
| PubChem CID | 64522575 |
| Molecular Formula | C17H22BrNO |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 1-(4-bromophenyl)-4-[cyclopropyl(cyclopropylmethyl)amino]butan-1-one |
| SMILES | O=C(CCCN(CC1CC1)C1CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H22BrNO/c18-15-7-5-14(6-8-15)17(20)2-1-11-19(16-9-10-16)12-13-3-4-13/h5-8,13,16H,1-4,9-12H2 |
| InChIKey | HDYCRPXVGZAPFH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |