C10H11N3O2S2 — CID 63569329
4-(thiophen-2-ylmethoxymethyl)-1,3-thiazole-2-carbohydrazide (PubChem CID 63569329) has the molecular formula C10H11N3O2S2 and a molecular weight of 269.35 g/mol. Its IUPAC name is 4-(thiophen-2-ylmethoxymethyl)-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-(thiophen-2-ylmethoxymethyl)-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 63569329 |
| Molecular Formula | C10H11N3O2S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 4-(thiophen-2-ylmethoxymethyl)-1,3-thiazole-2-carbohydrazide |
| SMILES | NNC(=O)c1nc(COCc2cccs2)cs1 |
| InChI | InChI=1S/C10H11N3O2S2/c11-13-9(14)10-12-7(6-17-10)4-15-5-8-2-1-3-16-8/h1-3,6H,4-5,11H2,(H,13,14) |
| InChIKey | KMJXOBOURBSINQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|