C11H17N3O3S — CID 63571274
4-(oxan-4-ylmethoxymethyl)-1,3-thiazole-2-carbohydrazide (PubChem CID 63571274) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 4-(oxan-4-ylmethoxymethyl)-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-(oxan-4-ylmethoxymethyl)-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 63571274 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-(oxan-4-ylmethoxymethyl)-1,3-thiazole-2-carbohydrazide |
| SMILES | NNC(=O)c1nc(COCC2CCOCC2)cs1 |
| InChI | InChI=1S/C11H17N3O3S/c12-14-10(15)11-13-9(7-18-11)6-17-5-8-1-3-16-4-2-8/h7-8H,1-6,12H2,(H,14,15) |
| InChIKey | QWCQPVXOCBKZRQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|