C20H17ClN2O3S — CID 6357022
(3aR,4S,8aR,8bR)-2-(4-chlorophenyl)-4-(thiophene-2-carbonyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione (PubChem CID 6357022) has the molecular formula C20H17ClN2O3S and a molecular weight of 400.89 g/mol. Its IUPAC name is (3aR,4S,8aR,8bR)-2-(4-chlorophenyl)-4-(thiophene-2-carbonyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione.
| Compound Name | (3aR,4S,8aR,8bR)-2-(4-chlorophenyl)-4-(thiophene-2-carbonyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
|---|---|
| PubChem CID | 6357022 |
| Molecular Formula | C20H17ClN2O3S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | (3aR,4S,8aR,8bR)-2-(4-chlorophenyl)-4-(thiophene-2-carbonyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
| SMILES | O=C(c1cccs1)[C@@H]1[C@@H]2C(=O)N(c3ccc(Cl)cc3)C(=O)[C@H]2[C@H]2CCCN21 |
| InChI | InChI=1S/C20H17ClN2O3S/c21-11-5-7-12(8-6-11)23-19(25)15-13-3-1-9-22(13)17(16(15)20(23)26)18(24)14-4-2-10-27-14/h2,4-8,10,13,15-17H,1,3,9H2/t13-,15+,16-,17+/m1/s1 |
| InChIKey | GSWJGDVCOGRWDV-XBVQOTNRSA-N |
| XLogP | 3.24 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|