C14H17N3O2S — CID 63570309
4-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]butanehydrazide (PubChem CID 63570309) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 4-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]butanehydrazide.
| Compound Name | 4-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]butanehydrazide |
|---|---|
| PubChem CID | 63570309 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 4-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]butanehydrazide |
| SMILES | Cc1csc(-c2ccc(OCCCC(=O)NN)cc2)n1 |
| InChI | InChI=1S/C14H17N3O2S/c1-10-9-20-14(16-10)11-4-6-12(7-5-11)19-8-2-3-13(18)17-15/h4-7,9H,2-3,8,15H2,1H3,(H,17,18) |
| InChIKey | COWOLMVIBVMIEZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|