C19H26N2O2S — CID 9123769
N-[(2S)-heptan-2-yl]-2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]acetamide (PubChem CID 9123769) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is N-[(2S)-heptan-2-yl]-2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]acetamide.
| Compound Name | N-[(2S)-heptan-2-yl]-2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 9123769 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-[(2S)-heptan-2-yl]-2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]acetamide |
| SMILES | CCCCC[C@H](C)NC(=O)COc1ccc(-c2nc(C)cs2)cc1 |
| InChI | InChI=1S/C19H26N2O2S/c1-4-5-6-7-14(2)20-18(22)12-23-17-10-8-16(9-11-17)19-21-15(3)13-24-19/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | AQSAVPKSCKZOIC-AWEZNQCLSA-N |
| XLogP | 4.58 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|