C11H15N3O4 — CID 63570531
2-(2,4-dimethyl-6-nitrophenoxy)propanehydrazide (PubChem CID 63570531) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-(2,4-dimethyl-6-nitrophenoxy)propanehydrazide.
| Compound Name | 2-(2,4-dimethyl-6-nitrophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 63570531 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-(2,4-dimethyl-6-nitrophenoxy)propanehydrazide |
| SMILES | Cc1cc(C)c(OC(C)C(=O)NN)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H15N3O4/c1-6-4-7(2)10(9(5-6)14(16)17)18-8(3)11(15)13-12/h4-5,8H,12H2,1-3H3,(H,13,15) |
| InChIKey | ANBNXUPZWIJLFF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|