C10H16N4O — CID 63571441
2-[methyl(pyridin-3-ylmethyl)amino]propanehydrazide (PubChem CID 63571441) has the molecular formula C10H16N4O and a molecular weight of 208.27 g/mol. Its IUPAC name is 2-[methyl(pyridin-3-ylmethyl)amino]propanehydrazide.
| Compound Name | 2-[methyl(pyridin-3-ylmethyl)amino]propanehydrazide |
|---|---|
| PubChem CID | 63571441 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.27 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-[methyl(pyridin-3-ylmethyl)amino]propanehydrazide |
| SMILES | CC(C(=O)NN)N(C)Cc1cccnc1 |
| InChI | InChI=1S/C10H16N4O/c1-8(10(15)13-11)14(2)7-9-4-3-5-12-6-9/h3-6,8H,7,11H2,1-2H3,(H,13,15) |
| InChIKey | NAZKCNYNGUQAPH-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.27 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|