C10H21N3O3 — CID 63571905
5-[[ethyl(2-hydroxyethyl)amino]methyl]oxolane-2-carbohydrazide (PubChem CID 63571905) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is 5-[[ethyl(2-hydroxyethyl)amino]methyl]oxolane-2-carbohydrazide.
| Compound Name | 5-[[ethyl(2-hydroxyethyl)amino]methyl]oxolane-2-carbohydrazide |
|---|---|
| PubChem CID | 63571905 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 5-[[ethyl(2-hydroxyethyl)amino]methyl]oxolane-2-carbohydrazide |
| SMILES | CCN(CCO)CC1CCC(C(=O)NN)O1 |
| InChI | InChI=1S/C10H21N3O3/c1-2-13(5-6-14)7-8-3-4-9(16-8)10(15)12-11/h8-9,14H,2-7,11H2,1H3,(H,12,15) |
| InChIKey | SVAREXOBLZZXHA-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|