C11H21NO4 — CID 62298724
5-[[ethyl(2-methoxyethyl)amino]methyl]oxolane-2-carboxylic acid (PubChem CID 62298724) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is 5-[[ethyl(2-methoxyethyl)amino]methyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[[ethyl(2-methoxyethyl)amino]methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 62298724 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 5-[[ethyl(2-methoxyethyl)amino]methyl]oxolane-2-carboxylic acid |
| SMILES | CCN(CCOC)CC1CCC(C(=O)O)O1 |
| InChI | InChI=1S/C11H21NO4/c1-3-12(6-7-15-2)8-9-4-5-10(16-9)11(13)14/h9-10H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | OTAFALBATMTFFB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |