C12H22N2O5 — CID 55053936
5-[[[2-(2-methoxyethylamino)-2-oxoethyl]-methylamino]methyl]oxolane-2-carboxylic acid (PubChem CID 55053936) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is 5-[[[2-(2-methoxyethylamino)-2-oxoethyl]-methylamino]methyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[[[2-(2-methoxyethylamino)-2-oxoethyl]-methylamino]methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 55053936 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 5-[[[2-(2-methoxyethylamino)-2-oxoethyl]-methylamino]methyl]oxolane-2-carboxylic acid |
| SMILES | COCCNC(=O)CN(C)CC1CCC(C(=O)O)O1 |
| InChI | InChI=1S/C12H22N2O5/c1-14(8-11(15)13-5-6-18-2)7-9-3-4-10(19-9)12(16)17/h9-10H,3-8H2,1-2H3,(H,13,15)(H,16,17) |
| InChIKey | ZTCXXZVPOZFBSS-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|