C11H18N2O5 — CID 93378992
cis-(1S,2R)-2-[[2-(2-methoxyethylamino)-2-oxoethyl]-methylcarbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 93378992) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is cis-(1S,2R)-2-[[2-(2-methoxyethylamino)-2-oxoethyl]-methylcarbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1S,2R)-2-[[2-(2-methoxyethylamino)-2-oxoethyl]-methylcarbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 93378992 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | cis-(1S,2R)-2-[[2-(2-methoxyethylamino)-2-oxoethyl]-methylcarbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | COCCNC(=O)CN(C)C(=O)[C@@H]1C[C@@H]1C(=O)O |
| InChI | InChI=1S/C11H18N2O5/c1-13(6-9(14)12-3-4-18-2)10(15)7-5-8(7)11(16)17/h7-8H,3-6H2,1-2H3,(H,12,14)(H,16,17)/t7-,8+/m1/s1 |
| InChIKey | AKXSWHVRZCUEFR-SFYZADRCSA-N |
| XLogP | -1.07 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|