C12H23N3O4 — CID 66250254
4-amino-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N,3-dimethyloxolane-3-carboxamide (PubChem CID 66250254) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is 4-amino-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N,3-dimethyloxolane-3-carboxamide.
| Compound Name | 4-amino-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N,3-dimethyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 66250254 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 4-amino-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N,3-dimethyloxolane-3-carboxamide |
| SMILES | COCCNC(=O)CN(C)C(=O)C1(C)COCC1N |
| InChI | InChI=1S/C12H23N3O4/c1-12(8-19-7-9(12)13)11(17)15(2)6-10(16)14-4-5-18-3/h9H,4-8,13H2,1-3H3,(H,14,16) |
| InChIKey | BDWMZHNXFCENHR-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|