C8H12N4O2 — CID 63572413
4-(2-oxopyrimidin-1-yl)butanehydrazide (PubChem CID 63572413) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 4-(2-oxopyrimidin-1-yl)butanehydrazide.
| Compound Name | 4-(2-oxopyrimidin-1-yl)butanehydrazide |
|---|---|
| PubChem CID | 63572413 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 4-(2-oxopyrimidin-1-yl)butanehydrazide |
| SMILES | NNC(=O)CCCn1cccnc1=O |
| InChI | InChI=1S/C8H12N4O2/c9-11-7(13)3-1-5-12-6-2-4-10-8(12)14/h2,4,6H,1,3,5,9H2,(H,11,13) |
| InChIKey | MOEAIWAJLCYOFT-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|