C11H22N4O3 — CID 63573012
1-[2-[2-hydroxyethyl(methyl)amino]acetyl]piperidine-4-carbohydrazide (PubChem CID 63573012) has the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 1-[2-[2-hydroxyethyl(methyl)amino]acetyl]piperidine-4-carbohydrazide.
| Compound Name | 1-[2-[2-hydroxyethyl(methyl)amino]acetyl]piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 63573012 |
| Molecular Formula | C11H22N4O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1-[2-[2-hydroxyethyl(methyl)amino]acetyl]piperidine-4-carbohydrazide |
| SMILES | CN(CCO)CC(=O)N1CCC(C(=O)NN)CC1 |
| InChI | InChI=1S/C11H22N4O3/c1-14(6-7-16)8-10(17)15-4-2-9(3-5-15)11(18)13-12/h9,16H,2-8,12H2,1H3,(H,13,18) |
| InChIKey | HKJHPZNSMISBGO-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|