C11H21N3O3S — CID 66128765
1-[2-(3-hydroxypropylsulfanyl)acetyl]piperidine-4-carbohydrazide (PubChem CID 66128765) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is 1-[2-(3-hydroxypropylsulfanyl)acetyl]piperidine-4-carbohydrazide.
| Compound Name | 1-[2-(3-hydroxypropylsulfanyl)acetyl]piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 66128765 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-[2-(3-hydroxypropylsulfanyl)acetyl]piperidine-4-carbohydrazide |
| SMILES | NNC(=O)C1CCN(C(=O)CSCCCO)CC1 |
| InChI | InChI=1S/C11H21N3O3S/c12-13-11(17)9-2-4-14(5-3-9)10(16)8-18-7-1-6-15/h9,15H,1-8,12H2,(H,13,17) |
| InChIKey | UFCCNPYVWFITBL-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|