About 5-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]furan-3-carbohydrazide
5-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]furan-3-carbohydrazide (PubChem CID 63581288) has the molecular formula C13H17N3O4
and a molecular weight of 279.30 g/mol. Its IUPAC name is 5-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]furan-3-carbohydrazide.
Molecular Properties
| Compound Name | 5-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]furan-3-carbohydrazide |
| PubChem CID | 63581288 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 5-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]furan-3-carbohydrazide |
| SMILES | CC1(C)CC(=O)N(Cc2cc(C(=O)NN)co2)C(=O)C1 |
| InChI | InChI=1S/C13H17N3O4/c1-13(2)4-10(17)16(11(18)5-13)6-9-3-8(7-20-9)12(19)15-14/h3,7H,4-6,14H2,1-2H3,(H,15,19) |
| InChIKey | JJFRGNQPQCDTIJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]furan-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]furan-3-carbohydrazide?
The IUPAC name of 5-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]furan-3-carbohydrazide (CID 63581288) is 5-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]furan-3-carbohydrazide.
What is the SMILES notation for 5-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]furan-3-carbohydrazide?
The canonical SMILES for 5-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]furan-3-carbohydrazide is CC1(C)CC(=O)N(Cc2cc(C(=O)NN)co2)C(=O)C1.
What is the InChIKey of 5-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]furan-3-carbohydrazide?
The InChIKey is JJFRGNQPQCDTIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O4/c1-13(2)4-10(17)16(11(18)5-13)6-9-3-8(7-20-9)12(19)15-14/h3,7H,4-6,14H2,1-2H3,(H,15,19).
What are the key properties of 5-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]furan-3-carbohydrazide?
5-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]furan-3-carbohydrazide has a molecular weight of 279.30 g/mol, XLogP of 0.56, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]furan-3-carbohydrazide is sourced from PubChem (CID 63581288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).