C11H9BrFN3O3 — CID 63582617
2-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)propanehydrazide (PubChem CID 63582617) has the molecular formula C11H9BrFN3O3 and a molecular weight of 330.11 g/mol. Its IUPAC name is 2-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)propanehydrazide.
| Compound Name | 2-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 63582617 |
| Molecular Formula | C11H9BrFN3O3 |
| Molecular Weight | 330.11 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 2-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)propanehydrazide |
| SMILES | CC(C(=O)NN)N1C(=O)C(=O)c2cc(Br)c(F)cc21 |
| InChI | InChI=1S/C11H9BrFN3O3/c1-4(10(18)15-14)16-8-3-7(13)6(12)2-5(8)9(17)11(16)19/h2-4H,14H2,1H3,(H,15,18) |
| InChIKey | BEIXFOAMEBXAAM-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.11 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|