C11H17N3O — CID 63583846
2-(N,3,5-trimethylanilino)acetohydrazide (PubChem CID 63583846) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 2-(N,3,5-trimethylanilino)acetohydrazide.
| Compound Name | 2-(N,3,5-trimethylanilino)acetohydrazide |
|---|---|
| PubChem CID | 63583846 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 2-(N,3,5-trimethylanilino)acetohydrazide |
| SMILES | Cc1cc(C)cc(N(C)CC(=O)NN)c1 |
| InChI | InChI=1S/C11H17N3O/c1-8-4-9(2)6-10(5-8)14(3)7-11(15)13-12/h4-6H,7,12H2,1-3H3,(H,13,15) |
| InChIKey | UDBSECMXTICBEH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|