About 2-(3-amino-N,5-dimethylanilino)acetamide
2-(3-amino-N,5-dimethylanilino)acetamide (PubChem CID 112647128) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(3-amino-N,5-dimethylanilino)acetamide.
Molecular Properties
| Compound Name | 2-(3-amino-N,5-dimethylanilino)acetamide |
| PubChem CID | 112647128 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 2-(3-amino-N,5-dimethylanilino)acetamide |
| SMILES | Cc1cc(N)cc(N(C)CC(N)=O)c1 |
| InChI | InChI=1S/C10H15N3O/c1-7-3-8(11)5-9(4-7)13(2)6-10(12)14/h3-5H,6,11H2,1-2H3,(H2,12,14) |
| InChIKey | VKFQIKMNVRYTIY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-amino-N,5-dimethylanilino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-N,5-dimethylanilino)acetamide?
The IUPAC name of 2-(3-amino-N,5-dimethylanilino)acetamide (CID 112647128) is 2-(3-amino-N,5-dimethylanilino)acetamide.
What is the SMILES notation for 2-(3-amino-N,5-dimethylanilino)acetamide?
The canonical SMILES for 2-(3-amino-N,5-dimethylanilino)acetamide is Cc1cc(N)cc(N(C)CC(N)=O)c1.
What is the InChIKey of 2-(3-amino-N,5-dimethylanilino)acetamide?
The InChIKey is VKFQIKMNVRYTIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O/c1-7-3-8(11)5-9(4-7)13(2)6-10(12)14/h3-5H,6,11H2,1-2H3,(H2,12,14).
What are the key properties of 2-(3-amino-N,5-dimethylanilino)acetamide?
2-(3-amino-N,5-dimethylanilino)acetamide has a molecular weight of 193.25 g/mol, XLogP of 0.50, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-N,5-dimethylanilino)acetamide is sourced from PubChem (CID 112647128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).