C10H16N2O — CID 112647088
2-(3-amino-N,5-dimethylanilino)ethanol (PubChem CID 112647088) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(3-amino-N,5-dimethylanilino)ethanol.
| Compound Name | 2-(3-amino-N,5-dimethylanilino)ethanol |
|---|---|
| PubChem CID | 112647088 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-(3-amino-N,5-dimethylanilino)ethanol |
| SMILES | Cc1cc(N)cc(N(C)CCO)c1 |
| InChI | InChI=1S/C10H16N2O/c1-8-5-9(11)7-10(6-8)12(2)3-4-13/h5-7,13H,3-4,11H2,1-2H3 |
| InChIKey | DQZZWYFFCQVQFK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|