C14H16FN3O2 — CID 63584129
5-[(N-ethyl-3-fluoroanilino)methyl]furan-2-carbohydrazide (PubChem CID 63584129) has the molecular formula C14H16FN3O2 and a molecular weight of 277.30 g/mol. Its IUPAC name is 5-[(N-ethyl-3-fluoroanilino)methyl]furan-2-carbohydrazide.
| Compound Name | 5-[(N-ethyl-3-fluoroanilino)methyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 63584129 |
| Molecular Formula | C14H16FN3O2 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 5-[(N-ethyl-3-fluoroanilino)methyl]furan-2-carbohydrazide |
| SMILES | CCN(Cc1ccc(C(=O)NN)o1)c1cccc(F)c1 |
| InChI | InChI=1S/C14H16FN3O2/c1-2-18(11-5-3-4-10(15)8-11)9-12-6-7-13(20-12)14(19)17-16/h3-8H,2,9,16H2,1H3,(H,17,19) |
| InChIKey | KNISPRFXAVZSGL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|