C10H18N4OS — CID 63585046
2-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]butanehydrazide (PubChem CID 63585046) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is 2-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]butanehydrazide.
| Compound Name | 2-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]butanehydrazide |
|---|---|
| PubChem CID | 63585046 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]butanehydrazide |
| SMILES | CCC(C(=O)NN)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C10H18N4OS/c1-4-9(10(15)13-11)14(3)5-8-6-16-7(2)12-8/h6,9H,4-5,11H2,1-3H3,(H,13,15) |
| InChIKey | DHOHIUMPELOURJ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|