C11H13ClN4O2S — CID 63585244
5-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-1,2-oxazole-3-carbohydrazide (PubChem CID 63585244) has the molecular formula C11H13ClN4O2S and a molecular weight of 300.77 g/mol. Its IUPAC name is 5-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 63585244 |
| Molecular Formula | C11H13ClN4O2S |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 5-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-1,2-oxazole-3-carbohydrazide |
| SMILES | CN(Cc1cc(C(=O)NN)no1)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H13ClN4O2S/c1-16(6-8-2-3-10(12)19-8)5-7-4-9(15-18-7)11(17)14-13/h2-4H,5-6,13H2,1H3,(H,14,17) |
| InChIKey | RBGAOBMLAABJNG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|