C11H18N2O4 — CID 63588542
5-(2-ethoxyethoxymethyl)-3-methylfuran-2-carbohydrazide (PubChem CID 63588542) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 5-(2-ethoxyethoxymethyl)-3-methylfuran-2-carbohydrazide.
| Compound Name | 5-(2-ethoxyethoxymethyl)-3-methylfuran-2-carbohydrazide |
|---|---|
| PubChem CID | 63588542 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 5-(2-ethoxyethoxymethyl)-3-methylfuran-2-carbohydrazide |
| SMILES | CCOCCOCc1cc(C)c(C(=O)NN)o1 |
| InChI | InChI=1S/C11H18N2O4/c1-3-15-4-5-16-7-9-6-8(2)10(17-9)11(14)13-12/h6H,3-5,7,12H2,1-2H3,(H,13,14) |
| InChIKey | HBYXJRNCTPAFQN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|