C12H24N2O2 — CID 63596930
1-[1-(1,3-dioxan-4-ylmethyl)piperidin-4-yl]ethanamine (PubChem CID 63596930) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-[1-(1,3-dioxan-4-ylmethyl)piperidin-4-yl]ethanamine.
| Compound Name | 1-[1-(1,3-dioxan-4-ylmethyl)piperidin-4-yl]ethanamine |
|---|---|
| PubChem CID | 63596930 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 1-[1-(1,3-dioxan-4-ylmethyl)piperidin-4-yl]ethanamine |
| SMILES | CC(N)C1CCN(CC2CCOCO2)CC1 |
| InChI | InChI=1S/C12H24N2O2/c1-10(13)11-2-5-14(6-3-11)8-12-4-7-15-9-16-12/h10-12H,2-9,13H2,1H3 |
| InChIKey | QHZBJPNQTLXCCA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |