C9H19NO2 — CID 130677377
N-(1,3-dioxan-4-ylmethyl)-N-methylpropan-2-amine (PubChem CID 130677377) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is N-(1,3-dioxan-4-ylmethyl)-N-methylpropan-2-amine.
| Compound Name | N-(1,3-dioxan-4-ylmethyl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 130677377 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | N-(1,3-dioxan-4-ylmethyl)-N-methylpropan-2-amine |
| SMILES | CC(C)N(C)CC1CCOCO1 |
| InChI | InChI=1S/C9H19NO2/c1-8(2)10(3)6-9-4-5-11-7-12-9/h8-9H,4-7H2,1-3H3 |
| InChIKey | CBVVDFHRNWOZMX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |