C13H16N2O2S — CID 63597926
2-methoxy-5-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]phenol (PubChem CID 63597926) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-methoxy-5-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]phenol.
| Compound Name | 2-methoxy-5-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 63597926 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-methoxy-5-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]phenol |
| SMILES | COc1ccc(CNC(C)c2nccs2)cc1O |
| InChI | InChI=1S/C13H16N2O2S/c1-9(13-14-5-6-18-13)15-8-10-3-4-12(17-2)11(16)7-10/h3-7,9,15-16H,8H2,1-2H3 |
| InChIKey | RVEQJSXLRMEBOJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |