C17H19N4O6S+ — CID 6360103
[amino-(3-nitrophenyl)methylidene]-[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]oxyazanium (PubChem CID 6360103) has the molecular formula C17H19N4O6S+ and a molecular weight of 407.43 g/mol. Its IUPAC name is [amino-(3-nitrophenyl)methylidene]-[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]oxyazanium.
| Compound Name | [amino-(3-nitrophenyl)methylidene]-[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]oxyazanium |
|---|---|
| PubChem CID | 6360103 |
| Molecular Formula | C17H19N4O6S+ |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | [amino-(3-nitrophenyl)methylidene]-[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]oxyazanium |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(=O)O[NH+]=C(N)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H18N4O6S/c1-12-6-8-15(9-7-12)28(25,26)20(2)11-16(22)27-19-17(18)13-4-3-5-14(10-13)21(23)24/h3-10H,11H2,1-2H3,(H2,18,19)/p+1 |
| InChIKey | LQMJDRDGHPWVOK-UHFFFAOYSA-O |
| XLogP | -0.53 |
| TPSA | 146.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|