C16H22N2O2 — CID 63605872
3,3-dimethyl-4-[3-(2-methylphenyl)propanoyl]piperazin-2-one (PubChem CID 63605872) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 3,3-dimethyl-4-[3-(2-methylphenyl)propanoyl]piperazin-2-one.
| Compound Name | 3,3-dimethyl-4-[3-(2-methylphenyl)propanoyl]piperazin-2-one |
|---|---|
| PubChem CID | 63605872 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 3,3-dimethyl-4-[3-(2-methylphenyl)propanoyl]piperazin-2-one |
| SMILES | Cc1ccccc1CCC(=O)N1CCNC(=O)C1(C)C |
| InChI | InChI=1S/C16H22N2O2/c1-12-6-4-5-7-13(12)8-9-14(19)18-11-10-17-15(20)16(18,2)3/h4-7H,8-11H2,1-3H3,(H,17,20) |
| InChIKey | VQDAFVICKAHRRE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |