C9H16N2O2S — CID 63606717
3,3-dimethyl-4-(2-methylsulfanylacetyl)piperazin-2-one (PubChem CID 63606717) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 3,3-dimethyl-4-(2-methylsulfanylacetyl)piperazin-2-one.
| Compound Name | 3,3-dimethyl-4-(2-methylsulfanylacetyl)piperazin-2-one |
|---|---|
| PubChem CID | 63606717 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3,3-dimethyl-4-(2-methylsulfanylacetyl)piperazin-2-one |
| SMILES | CSCC(=O)N1CCNC(=O)C1(C)C |
| InChI | InChI=1S/C9H16N2O2S/c1-9(2)8(13)10-4-5-11(9)7(12)6-14-3/h4-6H2,1-3H3,(H,10,13) |
| InChIKey | NDZCHCXZXOOZEF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |