C14H26N2O2 — CID 23790775
4-(3,4-dimethylhexanoyl)-3,3-dimethylpiperazin-2-one (PubChem CID 23790775) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 4-(3,4-dimethylhexanoyl)-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-(3,4-dimethylhexanoyl)-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 23790775 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 4-(3,4-dimethylhexanoyl)-3,3-dimethylpiperazin-2-one |
| SMILES | CCC(C)C(C)CC(=O)N1CCNC(=O)C1(C)C |
| InChI | InChI=1S/C14H26N2O2/c1-6-10(2)11(3)9-12(17)16-8-7-15-13(18)14(16,4)5/h10-11H,6-9H2,1-5H3,(H,15,18) |
| InChIKey | YNKQKVXJOVGWDJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |