C14H23N3O2 — CID 63608116
4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)-3-methylpiperazin-2-one (PubChem CID 63608116) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)-3-methylpiperazin-2-one.
| Compound Name | 4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 63608116 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)-3-methylpiperazin-2-one |
| SMILES | CC1C(=O)NCCN1C(=O)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C14H23N3O2/c1-9-13(18)15-6-7-17(9)14(19)12-8-10-4-2-3-5-11(10)16-12/h9-12,16H,2-8H2,1H3,(H,15,18) |
| InChIKey | BSZFVARDSAYGMS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |