C15H31N3O — CID 63610196
N-propyl-3-(3,3,4-trimethylpiperazin-1-yl)oxan-4-amine (PubChem CID 63610196) has the molecular formula C15H31N3O and a molecular weight of 269.43 g/mol. Its IUPAC name is N-propyl-3-(3,3,4-trimethylpiperazin-1-yl)oxan-4-amine.
| Compound Name | N-propyl-3-(3,3,4-trimethylpiperazin-1-yl)oxan-4-amine |
|---|---|
| PubChem CID | 63610196 |
| Molecular Formula | C15H31N3O |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.25 |
| IUPAC Name | N-propyl-3-(3,3,4-trimethylpiperazin-1-yl)oxan-4-amine |
| SMILES | CCCNC1CCOCC1N1CCN(C)C(C)(C)C1 |
| InChI | InChI=1S/C15H31N3O/c1-5-7-16-13-6-10-19-11-14(13)18-9-8-17(4)15(2,3)12-18/h13-14,16H,5-12H2,1-4H3 |
| InChIKey | WODUXANGBYIRIX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |