C10H9BrN2O2S — CID 63611449
2-(4-bromothiophen-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 63611449) has the molecular formula C10H9BrN2O2S and a molecular weight of 301.17 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 2-(4-bromothiophen-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 63611449 |
| Molecular Formula | C10H9BrN2O2S |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | CCc1c(O)nc(-c2cc(Br)cs2)[nH]c1=O |
| InChI | InChI=1S/C10H9BrN2O2S/c1-2-6-9(14)12-8(13-10(6)15)7-3-5(11)4-16-7/h3-4H,2H2,1H3,(H2,12,13,14,15) |
| InChIKey | IGDNIASZOVBFPP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |