C15H15NO3S2 — CID 63616313
5-methyl-2-[(2-methyl-5-methylsulfanylbenzoyl)amino]thiophene-3-carboxylic acid (PubChem CID 63616313) has the molecular formula C15H15NO3S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 5-methyl-2-[(2-methyl-5-methylsulfanylbenzoyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 5-methyl-2-[(2-methyl-5-methylsulfanylbenzoyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63616313 |
| Molecular Formula | C15H15NO3S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 5-methyl-2-[(2-methyl-5-methylsulfanylbenzoyl)amino]thiophene-3-carboxylic acid |
| SMILES | CSc1ccc(C)c(C(=O)Nc2sc(C)cc2C(=O)O)c1 |
| InChI | InChI=1S/C15H15NO3S2/c1-8-4-5-10(20-3)7-11(8)13(17)16-14-12(15(18)19)6-9(2)21-14/h4-7H,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | LVOCUHROTOEKKL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |