C13H10ClNO4S — CID 63615501
2-[(4-chloro-2-hydroxybenzoyl)amino]-5-methylthiophene-3-carboxylic acid (PubChem CID 63615501) has the molecular formula C13H10ClNO4S and a molecular weight of 311.75 g/mol. Its IUPAC name is 2-[(4-chloro-2-hydroxybenzoyl)amino]-5-methylthiophene-3-carboxylic acid.
| Compound Name | 2-[(4-chloro-2-hydroxybenzoyl)amino]-5-methylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63615501 |
| Molecular Formula | C13H10ClNO4S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 2-[(4-chloro-2-hydroxybenzoyl)amino]-5-methylthiophene-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(NC(=O)c2ccc(Cl)cc2O)s1 |
| InChI | InChI=1S/C13H10ClNO4S/c1-6-4-9(13(18)19)12(20-6)15-11(17)8-3-2-7(14)5-10(8)16/h2-5,16H,1H3,(H,15,17)(H,18,19) |
| InChIKey | UVHYWNWQNLPOIQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |