C13H9BrClNO3S — CID 63616323
2-[(4-bromo-2-chlorobenzoyl)amino]-5-methylthiophene-3-carboxylic acid (PubChem CID 63616323) has the molecular formula C13H9BrClNO3S and a molecular weight of 374.64 g/mol. Its IUPAC name is 2-[(4-bromo-2-chlorobenzoyl)amino]-5-methylthiophene-3-carboxylic acid.
| Compound Name | 2-[(4-bromo-2-chlorobenzoyl)amino]-5-methylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63616323 |
| Molecular Formula | C13H9BrClNO3S |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 372.92 |
| IUPAC Name | 2-[(4-bromo-2-chlorobenzoyl)amino]-5-methylthiophene-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(NC(=O)c2ccc(Br)cc2Cl)s1 |
| InChI | InChI=1S/C13H9BrClNO3S/c1-6-4-9(13(18)19)12(20-6)16-11(17)8-3-2-7(14)5-10(8)15/h2-5H,1H3,(H,16,17)(H,18,19) |
| InChIKey | KAPUAOYEYYRKIA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |