C12H27NO3 — CID 63619186
N-(2,2-diethoxyethyl)-N-ethyl-1-methoxypropan-2-amine (PubChem CID 63619186) has the molecular formula C12H27NO3 and a molecular weight of 233.35 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-N-ethyl-1-methoxypropan-2-amine.
| Compound Name | N-(2,2-diethoxyethyl)-N-ethyl-1-methoxypropan-2-amine |
|---|---|
| PubChem CID | 63619186 |
| Molecular Formula | C12H27NO3 |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | N-(2,2-diethoxyethyl)-N-ethyl-1-methoxypropan-2-amine |
| SMILES | CCOC(CN(CC)C(C)COC)OCC |
| InChI | InChI=1S/C12H27NO3/c1-6-13(11(4)10-14-5)9-12(15-7-2)16-8-3/h11-12H,6-10H2,1-5H3 |
| InChIKey | ROSHFLYVPTYJJC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|