C14H31NO3 — CID 63618872
N-(2,2-diethoxyethyl)-N-(2-methoxyethyl)pentan-3-amine (PubChem CID 63618872) has the molecular formula C14H31NO3 and a molecular weight of 261.41 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-N-(2-methoxyethyl)pentan-3-amine.
| Compound Name | N-(2,2-diethoxyethyl)-N-(2-methoxyethyl)pentan-3-amine |
|---|---|
| PubChem CID | 63618872 |
| Molecular Formula | C14H31NO3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.23 |
| IUPAC Name | N-(2,2-diethoxyethyl)-N-(2-methoxyethyl)pentan-3-amine |
| SMILES | CCOC(CN(CCOC)C(CC)CC)OCC |
| InChI | InChI=1S/C14H31NO3/c1-6-13(7-2)15(10-11-16-5)12-14(17-8-3)18-9-4/h13-14H,6-12H2,1-5H3 |
| InChIKey | TZFSKHOWCLKERC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|