C13H16BrN3O3 — CID 63623606
2-bromo-5-nitro-N-(2-pyrrolidin-3-ylethyl)benzamide (PubChem CID 63623606) has the molecular formula C13H16BrN3O3 and a molecular weight of 342.19 g/mol. Its IUPAC name is 2-bromo-5-nitro-N-(2-pyrrolidin-3-ylethyl)benzamide.
| Compound Name | 2-bromo-5-nitro-N-(2-pyrrolidin-3-ylethyl)benzamide |
|---|---|
| PubChem CID | 63623606 |
| Molecular Formula | C13H16BrN3O3 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-bromo-5-nitro-N-(2-pyrrolidin-3-ylethyl)benzamide |
| SMILES | O=C(NCCC1CCNC1)c1cc([N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C13H16BrN3O3/c14-12-2-1-10(17(19)20)7-11(12)13(18)16-6-4-9-3-5-15-8-9/h1-2,7,9,15H,3-6,8H2,(H,16,18) |
| InChIKey | PNFIDEAULNQKDK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|