C15H26N2O2 — CID 63629114
3,3-diethoxy-N-methyl-N-(2-pyridin-4-ylethyl)propan-1-amine (PubChem CID 63629114) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 3,3-diethoxy-N-methyl-N-(2-pyridin-4-ylethyl)propan-1-amine.
| Compound Name | 3,3-diethoxy-N-methyl-N-(2-pyridin-4-ylethyl)propan-1-amine |
|---|---|
| PubChem CID | 63629114 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 3,3-diethoxy-N-methyl-N-(2-pyridin-4-ylethyl)propan-1-amine |
| SMILES | CCOC(CCN(C)CCc1ccncc1)OCC |
| InChI | InChI=1S/C15H26N2O2/c1-4-18-15(19-5-2)9-13-17(3)12-8-14-6-10-16-11-7-14/h6-7,10-11,15H,4-5,8-9,12-13H2,1-3H3 |
| InChIKey | FTZSYSXSYDHABQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|