C13H9N3O4S — CID 63630342
2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 63630342) has the molecular formula C13H9N3O4S and a molecular weight of 303.30 g/mol. Its IUPAC name is 2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 63630342 |
| Molecular Formula | C13H9N3O4S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(CN2C(=O)c3cccnc3C2=O)sc1C(=O)O |
| InChI | InChI=1S/C13H9N3O4S/c1-6-10(13(19)20)21-8(15-6)5-16-11(17)7-3-2-4-14-9(7)12(16)18/h2-4H,5H2,1H3,(H,19,20) |
| InChIKey | HOVPQEHDPWHKMC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|