C12H24N2O — CID 63635156
5-(3,3,4-trimethylpiperazin-1-yl)pentan-2-one (PubChem CID 63635156) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 5-(3,3,4-trimethylpiperazin-1-yl)pentan-2-one.
| Compound Name | 5-(3,3,4-trimethylpiperazin-1-yl)pentan-2-one |
|---|---|
| PubChem CID | 63635156 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 5-(3,3,4-trimethylpiperazin-1-yl)pentan-2-one |
| SMILES | CC(=O)CCCN1CCN(C)C(C)(C)C1 |
| InChI | InChI=1S/C12H24N2O/c1-11(15)6-5-7-14-9-8-13(4)12(2,3)10-14/h5-10H2,1-4H3 |
| InChIKey | CEHBFGNIHVFVET-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |