C15H18N6 — CID 63639635
[2-(1H-benzimidazol-2-ylmethyl)-5-ethyl-6-methylpyrimidin-4-yl]hydrazine (PubChem CID 63639635) has the molecular formula C15H18N6 and a molecular weight of 282.35 g/mol. Its IUPAC name is [2-(1H-benzimidazol-2-ylmethyl)-5-ethyl-6-methylpyrimidin-4-yl]hydrazine.
| Compound Name | [2-(1H-benzimidazol-2-ylmethyl)-5-ethyl-6-methylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 63639635 |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | [2-(1H-benzimidazol-2-ylmethyl)-5-ethyl-6-methylpyrimidin-4-yl]hydrazine |
| SMILES | CCc1c(C)nc(Cc2nc3ccccc3[nH]2)nc1NN |
| InChI | InChI=1S/C15H18N6/c1-3-10-9(2)17-13(20-15(10)21-16)8-14-18-11-6-4-5-7-12(11)19-14/h4-7H,3,8,16H2,1-2H3,(H,18,19)(H,17,20,21) |
| InChIKey | NETOOHOUEBGPTM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|