C13H11N3O4S — CID 63650927
4-[(5-acetamidothiophene-2-carbonyl)amino]pyridine-2-carboxylic acid (PubChem CID 63650927) has the molecular formula C13H11N3O4S and a molecular weight of 305.32 g/mol. Its IUPAC name is 4-[(5-acetamidothiophene-2-carbonyl)amino]pyridine-2-carboxylic acid.
| Compound Name | 4-[(5-acetamidothiophene-2-carbonyl)amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 63650927 |
| Molecular Formula | C13H11N3O4S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 4-[(5-acetamidothiophene-2-carbonyl)amino]pyridine-2-carboxylic acid |
| SMILES | CC(=O)Nc1ccc(C(=O)Nc2ccnc(C(=O)O)c2)s1 |
| InChI | InChI=1S/C13H11N3O4S/c1-7(17)15-11-3-2-10(21-11)12(18)16-8-4-5-14-9(6-8)13(19)20/h2-6H,1H3,(H,15,17)(H,19,20)(H,14,16,18) |
| InChIKey | NWEFAANYMYJJTE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |